C16H24N2O4 — CID 122021168
4-[[(2-hydroxy-2,3-dimethylpentyl)carbamoylamino]methyl]benzoic acid (PubChem CID 122021168) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[[(2-hydroxy-2,3-dimethylpentyl)carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2-hydroxy-2,3-dimethylpentyl)carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122021168 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-[[(2-hydroxy-2,3-dimethylpentyl)carbamoylamino]methyl]benzoic acid |
| SMILES | CCC(C)C(C)(O)CNC(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H24N2O4/c1-4-11(2)16(3,22)10-18-15(21)17-9-12-5-7-13(8-6-12)14(19)20/h5-8,11,22H,4,9-10H2,1-3H3,(H,19,20)(H2,17,18,21) |
| InChIKey | LEORBCUCZDEVCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |