C23H31N3O3 — CID 122002061
4-[[[2-ethyl-2-(1-phenylethylamino)butyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122002061) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[[[2-ethyl-2-(1-phenylethylamino)butyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[2-ethyl-2-(1-phenylethylamino)butyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122002061 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 4-[[[2-ethyl-2-(1-phenylethylamino)butyl]carbamoylamino]methyl]benzoic acid |
| SMILES | CCC(CC)(CNC(=O)NCc1ccc(C(=O)O)cc1)NC(C)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O3/c1-4-23(5-2,26-17(3)19-9-7-6-8-10-19)16-25-22(29)24-15-18-11-13-20(14-12-18)21(27)28/h6-14,17,26H,4-5,15-16H2,1-3H3,(H,27,28)(H2,24,25,29) |
| InChIKey | ANCAPVZWVLWLSW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |