C20H27N3O5 — CID 70820607
tert-butyl 2-[3-[(3-ethoxy-3-oxopropyl)amino]-3-oxopropyl]benzimidazole-1-carboxylate (PubChem CID 70820607) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is tert-butyl 2-[3-[(3-ethoxy-3-oxopropyl)amino]-3-oxopropyl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[(3-ethoxy-3-oxopropyl)amino]-3-oxopropyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 70820607 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl 2-[3-[(3-ethoxy-3-oxopropyl)amino]-3-oxopropyl]benzimidazole-1-carboxylate |
| SMILES | CCOC(=O)CCNC(=O)CCc1nc2ccccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27N3O5/c1-5-27-18(25)12-13-21-17(24)11-10-16-22-14-8-6-7-9-15(14)23(16)19(26)28-20(2,3)4/h6-9H,5,10-13H2,1-4H3,(H,21,24) |
| InChIKey | IWUUIMLZZGQBSY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |