C14H19N4O3- — CID 19876932
N-butyl-2-methylbenzimidazole-1-carboxamide carbamate (PubChem CID 19876932) has the molecular formula C14H19N4O3- and a molecular weight of 291.33 g/mol. Its IUPAC name is N-butyl-2-methylbenzimidazole-1-carboxamide carbamate.
| Compound Name | N-butyl-2-methylbenzimidazole-1-carboxamide carbamate |
|---|---|
| PubChem CID | 19876932 |
| Molecular Formula | C14H19N4O3- |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-butyl-2-methylbenzimidazole-1-carboxamide carbamate |
| SMILES | CCCCNC(=O)n1c(C)nc2ccccc21.NC(=O)[O-] |
| InChI | InChI=1S/C13H17N3O.CH3NO2/c1-3-4-9-14-13(17)16-10(2)15-11-7-5-6-8-12(11)16;2-1(3)4/h5-8H,3-4,9H2,1-2H3,(H,14,17);2H2,(H,3,4)/p-1 |
| InChIKey | IPBRBRDELRZXOA-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|