C16H21N4O3- — CID 57376670
N-[1-(hexylcarbamoyl)benzimidazol-2-yl]-N-methylcarbamate (PubChem CID 57376670) has the molecular formula C16H21N4O3- and a molecular weight of 317.37 g/mol. Its IUPAC name is N-[1-(hexylcarbamoyl)benzimidazol-2-yl]-N-methylcarbamate.
| Compound Name | N-[1-(hexylcarbamoyl)benzimidazol-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 57376670 |
| Molecular Formula | C16H21N4O3- |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[1-(hexylcarbamoyl)benzimidazol-2-yl]-N-methylcarbamate |
| SMILES | CCCCCCNC(=O)n1c(N(C)C(=O)[O-])nc2ccccc21 |
| InChI | InChI=1S/C16H22N4O3/c1-3-4-5-8-11-17-15(21)20-13-10-7-6-9-12(13)18-14(20)19(2)16(22)23/h6-7,9-10H,3-5,8,11H2,1-2H3,(H,17,21)(H,22,23)/p-1 |
| InChIKey | YLELXSGQPVESOK-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|