C37H45N11O9S2 — CID 87339867
ethyl N-[[2-(ethoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate (PubChem CID 87339867) has the molecular formula C37H45N11O9S2 and a molecular weight of 851.97 g/mol. Its IUPAC name is ethyl N-[[2-(ethoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate.
| Compound Name | ethyl N-[[2-(ethoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 87339867 |
| Molecular Formula | C37H45N11O9S2 |
| Molecular Weight | 851.97 g/mol |
| Exact Mass | 851.28 |
| IUPAC Name | ethyl N-[[2-(ethoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate |
| SMILES | CCCCNC(=O)n1c(NC(=O)OC)nc2ccccc21.CCOC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OCC.COC(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H18N4O4S2.C14H18N4O3.C9H9N3O2/c1-3-21-13(19)17-11(23)15-9-7-5-6-8-10(9)16-12(24)18-14(20)22-4-2;1-3-4-9-15-13(19)18-11-8-6-5-7-10(11)16-12(18)17-14(20)21-2;1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h5-8H,3-4H2,1-2H3,(H2,15,17,19,23)(H2,16,18,20,24);5-8H,3-4,9H2,1-2H3,(H,15,19)(H,16,17,20);2-5H,1H3,(H2,10,11,12,13) |
| InChIKey | LGEOGEONXLNTHC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 252.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.97 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|