C14H18N4O3 — CID 21405106
butyl 2-(1H-benzimidazol-2-ylcarbamoylamino)acetate (PubChem CID 21405106) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is butyl 2-(1H-benzimidazol-2-ylcarbamoylamino)acetate.
| Compound Name | butyl 2-(1H-benzimidazol-2-ylcarbamoylamino)acetate |
|---|---|
| PubChem CID | 21405106 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | butyl 2-(1H-benzimidazol-2-ylcarbamoylamino)acetate |
| SMILES | CCCCOC(=O)CNC(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H18N4O3/c1-2-3-8-21-12(19)9-15-14(20)18-13-16-10-6-4-5-7-11(10)17-13/h4-7H,2-3,8-9H2,1H3,(H3,15,16,17,18,20) |
| InChIKey | VUNXOXHVGKFHLB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|