About 1H-benzimidazol-2-yl butyl carbonate
1H-benzimidazol-2-yl butyl carbonate (PubChem CID 174919281) has the molecular formula C12H14N2O3
and a molecular weight of 234.26 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl butyl carbonate.
Molecular Properties
| Compound Name | 1H-benzimidazol-2-yl butyl carbonate |
| PubChem CID | 174919281 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1H-benzimidazol-2-yl butyl carbonate |
| SMILES | CCCCOC(=O)Oc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H14N2O3/c1-2-3-8-16-12(15)17-11-13-9-6-4-5-7-10(9)14-11/h4-7H,2-3,8H2,1H3,(H,13,14) |
| InChIKey | BHALNCNTBWOKRT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-2-yl butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-2-yl butyl carbonate?
The IUPAC name of 1H-benzimidazol-2-yl butyl carbonate (CID 174919281) is 1H-benzimidazol-2-yl butyl carbonate.
What is the SMILES notation for 1H-benzimidazol-2-yl butyl carbonate?
The canonical SMILES for 1H-benzimidazol-2-yl butyl carbonate is CCCCOC(=O)Oc1nc2ccccc2[nH]1.
What is the InChIKey of 1H-benzimidazol-2-yl butyl carbonate?
The InChIKey is BHALNCNTBWOKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-2-3-8-16-12(15)17-11-13-9-6-4-5-7-10(9)14-11/h4-7H,2-3,8H2,1H3,(H,13,14).
What are the key properties of 1H-benzimidazol-2-yl butyl carbonate?
1H-benzimidazol-2-yl butyl carbonate has a molecular weight of 234.26 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-2-yl butyl carbonate is sourced from PubChem (CID 174919281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).