C20H30N2O4 — CID 143584796
tert-butyl N-[(6S)-7-(1,3-benzoxazol-2-yl)-7-hydroxy-6-methylheptyl]carbamate (PubChem CID 143584796) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl N-[(6S)-7-(1,3-benzoxazol-2-yl)-7-hydroxy-6-methylheptyl]carbamate.
| Compound Name | tert-butyl N-[(6S)-7-(1,3-benzoxazol-2-yl)-7-hydroxy-6-methylheptyl]carbamate |
|---|---|
| PubChem CID | 143584796 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butyl N-[(6S)-7-(1,3-benzoxazol-2-yl)-7-hydroxy-6-methylheptyl]carbamate |
| SMILES | C[C@@H](CCCCCNC(=O)OC(C)(C)C)C(O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C20H30N2O4/c1-14(10-6-5-9-13-21-19(24)26-20(2,3)4)17(23)18-22-15-11-7-8-12-16(15)25-18/h7-8,11-12,14,17,23H,5-6,9-10,13H2,1-4H3,(H,21,24)/t14-,17?/m0/s1 |
| InChIKey | CUGRWUOYKDUAGN-MBIQTGHCSA-N |
| XLogP | 4.58 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|