C22H30N2O4 — CID 54507168
methyl 7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-quinolin-3-ylheptanoate (PubChem CID 54507168) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl 7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-quinolin-3-ylheptanoate.
| Compound Name | methyl 7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-quinolin-3-ylheptanoate |
|---|---|
| PubChem CID | 54507168 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | methyl 7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-quinolin-3-ylheptanoate |
| SMILES | COC(=O)CC(CCCCNC(=O)OC(C)(C)C)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C22H30N2O4/c1-22(2,3)28-21(26)23-12-8-7-9-16(14-20(25)27-4)18-13-17-10-5-6-11-19(17)24-15-18/h5-6,10-11,13,15-16H,7-9,12,14H2,1-4H3,(H,23,26) |
| InChIKey | YGNJTYDSJAZAPR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|