C19H26N2O2 — CID 139378061
tert-butyl N-[2-(quinolin-3-ylmethyl)butyl]carbamate (PubChem CID 139378061) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl N-[2-(quinolin-3-ylmethyl)butyl]carbamate.
| Compound Name | tert-butyl N-[2-(quinolin-3-ylmethyl)butyl]carbamate |
|---|---|
| PubChem CID | 139378061 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | tert-butyl N-[2-(quinolin-3-ylmethyl)butyl]carbamate |
| SMILES | CCC(CNC(=O)OC(C)(C)C)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C19H26N2O2/c1-5-14(12-21-18(22)23-19(2,3)4)10-15-11-16-8-6-7-9-17(16)20-13-15/h6-9,11,13-14H,5,10,12H2,1-4H3,(H,21,22) |
| InChIKey | YBGDYAJTSSNFLJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |