C23H24ClN5O2 — CID 146314852
2-chloro-N-[4-(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)butyl]benzamide (PubChem CID 146314852) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-chloro-N-[4-(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)butyl]benzamide.
| Compound Name | 2-chloro-N-[4-(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)butyl]benzamide |
|---|---|
| PubChem CID | 146314852 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-chloro-N-[4-(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)butyl]benzamide |
| SMILES | COc1cc2nc(CCCCNC(=O)c3ccccc3Cl)c3nnc(C)n3c2cc1C |
| InChI | InChI=1S/C23H24ClN5O2/c1-14-12-20-19(13-21(14)31-3)26-18(22-28-27-15(2)29(20)22)10-6-7-11-25-23(30)16-8-4-5-9-17(16)24/h4-5,8-9,12-13H,6-7,10-11H2,1-3H3,(H,25,30) |
| InChIKey | UNBVRQUDJZUNMS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|