C25H23ClN4O3 — CID 17030763
2-chloro-N-[2-[1-[2-(2-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17030763) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[2-(2-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[1-[2-(2-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17030763 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-chloro-N-[2-[1-[2-(2-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | COc1ccccc1NC(=O)Cn1c(CCNC(=O)c2ccccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C25H23ClN4O3/c1-33-22-13-7-5-11-20(22)29-24(31)16-30-21-12-6-4-10-19(21)28-23(30)14-15-27-25(32)17-8-2-3-9-18(17)26/h2-13H,14-16H2,1H3,(H,27,32)(H,29,31) |
| InChIKey | LVLSOFDJSHVOGT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |