C25H22Cl2N4O2 — CID 17031501
2-chloro-N-[3-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 17031501) has the molecular formula C25H22Cl2N4O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is 2-chloro-N-[3-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 2-chloro-N-[3-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 17031501 |
| Molecular Formula | C25H22Cl2N4O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-chloro-N-[3-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | O=C(Cn1c(CCCNC(=O)c2ccccc2Cl)nc2ccccc21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H22Cl2N4O2/c26-17-7-5-8-18(15-17)29-24(32)16-31-22-12-4-3-11-21(22)30-23(31)13-6-14-28-25(33)19-9-1-2-10-20(19)27/h1-5,7-12,15H,6,13-14,16H2,(H,28,33)(H,29,32) |
| InChIKey | KJXYHDZQJZDEDH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|