C25H22ClN3O2 — CID 16982819
2-chloro-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]benzamide (PubChem CID 16982819) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-chloro-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]benzamide.
| Compound Name | 2-chloro-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 16982819 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-chloro-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]benzamide |
| SMILES | O=C(Cn1c(CCCNC(=O)c2ccccc2Cl)nc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H22ClN3O2/c26-20-12-5-4-11-19(20)25(31)27-16-8-15-24-28-21-13-6-7-14-22(21)29(24)17-23(30)18-9-2-1-3-10-18/h1-7,9-14H,8,15-17H2,(H,27,31) |
| InChIKey | RMNHOQOBPQQQHB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|