C28H30N4O2 — CID 17031470
N-[3-[1-[2-(3,4-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-methylbenzamide (PubChem CID 17031470) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[3-[1-[2-(3,4-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-methylbenzamide.
| Compound Name | N-[3-[1-[2-(3,4-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 17031470 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-[3-[1-[2-(3,4-dimethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-methylbenzamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(CCCNC(=O)c3ccccc3C)nc3ccccc32)cc1C |
| InChI | InChI=1S/C28H30N4O2/c1-19-14-15-22(17-21(19)3)30-27(33)18-32-25-12-7-6-11-24(25)31-26(32)13-8-16-29-28(34)23-10-5-4-9-20(23)2/h4-7,9-12,14-15,17H,8,13,16,18H2,1-3H3,(H,29,34)(H,30,33) |
| InChIKey | WWPGSDCJDUHPBY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|