C27H28N4O2S — CID 17031456
2-methyl-N-[3-[1-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 17031456) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is 2-methyl-N-[3-[1-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 2-methyl-N-[3-[1-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 17031456 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-methyl-N-[3-[1-[2-(3-methylsulfanylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | CSc1cccc(NC(=O)Cn2c(CCCNC(=O)c3ccccc3C)nc3ccccc32)c1 |
| InChI | InChI=1S/C27H28N4O2S/c1-19-9-3-4-12-22(19)27(33)28-16-8-15-25-30-23-13-5-6-14-24(23)31(25)18-26(32)29-20-10-7-11-21(17-20)34-2/h3-7,9-14,17H,8,15-16,18H2,1-2H3,(H,28,33)(H,29,32) |
| InChIKey | HWZVRLSNWFLDIS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|