C24H20Cl2N4O2 — CID 17030913
4-chloro-N-[2-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17030913) has the molecular formula C24H20Cl2N4O2 and a molecular weight of 467.36 g/mol. Its IUPAC name is 4-chloro-N-[2-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17030913 |
| Molecular Formula | C24H20Cl2N4O2 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 4-chloro-N-[2-[1-[2-(3-chloroanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | O=C(Cn1c(CCNC(=O)c2ccc(Cl)cc2)nc2ccccc21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N4O2/c25-17-10-8-16(9-11-17)24(32)27-13-12-22-29-20-6-1-2-7-21(20)30(22)15-23(31)28-19-5-3-4-18(26)14-19/h1-11,14H,12-13,15H2,(H,27,32)(H,28,31) |
| InChIKey | UGISLMJEVDPKBR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |