C11H15N5 — CID 142489177
2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine;ethane (PubChem CID 142489177) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine;ethane.
| Compound Name | 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine;ethane |
|---|---|
| PubChem CID | 142489177 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2,3-dihydro-1H-imidazo[4,5-g]quinazolin-8-amine;ethane |
| SMILES | CC.Nc1ncnc2cc3c(cc12)NCN3 |
| InChI | InChI=1S/C9H9N5.C2H6/c10-9-5-1-7-8(13-3-12-7)2-6(5)11-4-14-9;1-2/h1-2,4,12-13H,3H2,(H2,10,11,14);1-2H3 |
| InChIKey | JFDPYNCBISXAMW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |