C17H23N5O2 — CID 141289176
1-[4-[3-(4-aminoquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanone (PubChem CID 141289176) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[4-[3-(4-aminoquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(4-aminoquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 141289176 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-[4-[3-(4-aminoquinazolin-7-yl)oxypropyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CCCOc2ccc3c(N)ncnc3c2)CC1 |
| InChI | InChI=1S/C17H23N5O2/c1-13(23)22-8-6-21(7-9-22)5-2-10-24-14-3-4-15-16(11-14)19-12-20-17(15)18/h3-4,11-12H,2,5-10H2,1H3,(H2,18,19,20) |
| InChIKey | SCZWONWRWISCPL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|