C24H32F3N5O3 — CID 165385756
5-methoxy-4-[[4-[4-morpholin-4-yl-N-(2,2,2-trifluoroethyl)anilino]cyclohexyl]methoxy]pyrimidin-2-amine (PubChem CID 165385756) has the molecular formula C24H32F3N5O3 and a molecular weight of 495.55 g/mol. Its IUPAC name is 5-methoxy-4-[[4-[4-morpholin-4-yl-N-(2,2,2-trifluoroethyl)anilino]cyclohexyl]methoxy]pyrimidin-2-amine.
| Compound Name | 5-methoxy-4-[[4-[4-morpholin-4-yl-N-(2,2,2-trifluoroethyl)anilino]cyclohexyl]methoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 165385756 |
| Molecular Formula | C24H32F3N5O3 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 5-methoxy-4-[[4-[4-morpholin-4-yl-N-(2,2,2-trifluoroethyl)anilino]cyclohexyl]methoxy]pyrimidin-2-amine |
| SMILES | COc1cnc(N)nc1OCC1CCC(N(CC(F)(F)F)c2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C24H32F3N5O3/c1-33-21-14-29-23(28)30-22(21)35-15-17-2-4-19(5-3-17)32(16-24(25,26)27)20-8-6-18(7-9-20)31-10-12-34-13-11-31/h6-9,14,17,19H,2-5,10-13,15-16H2,1H3,(H2,28,29,30) |
| InChIKey | MLWNPAQTAGTVHA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|