C19H21N5O3 — CID 11996073
6-(3,4-dimethoxyphenyl)-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-2-amine (PubChem CID 11996073) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 11996073 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-2-amine |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCOCC4)c3c2)cc1OC |
| InChI | InChI=1S/C19H21N5O3/c1-25-15-4-3-12(10-16(15)26-2)13-9-14-17(21-11-13)22-19(20)23-18(14)24-5-7-27-8-6-24/h3-4,9-11H,5-8H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | XXWBQBVFYYRUOV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |