C16H21N5O — CID 21290634
5-[1-(4-methoxyphenyl)piperidin-4-yl]pyrimidine-2,4-diamine (PubChem CID 21290634) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 5-[1-(4-methoxyphenyl)piperidin-4-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-[1-(4-methoxyphenyl)piperidin-4-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21290634 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 5-[1-(4-methoxyphenyl)piperidin-4-yl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(N2CCC(c3cnc(N)nc3N)CC2)cc1 |
| InChI | InChI=1S/C16H21N5O/c1-22-13-4-2-12(3-5-13)21-8-6-11(7-9-21)14-10-19-16(18)20-15(14)17/h2-5,10-11H,6-9H2,1H3,(H4,17,18,19,20) |
| InChIKey | VTQGRSGUJPAUPZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|