C14H16N4O — CID 174851736
5-cyclopropyl-6-(4-methoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 174851736) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 5-cyclopropyl-6-(4-methoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-cyclopropyl-6-(4-methoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174851736 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5-cyclopropyl-6-(4-methoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(-c2nc(N)nc(N)c2C2CC2)cc1 |
| InChI | InChI=1S/C14H16N4O/c1-19-10-6-4-9(5-7-10)12-11(8-2-3-8)13(15)18-14(16)17-12/h4-8H,2-3H2,1H3,(H4,15,16,17,18) |
| InChIKey | YTMCKFSWFNBGNV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |