C19H19BN4O4S — CID 89260405
CID 89260405 (PubChem CID 89260405) has the molecular formula C19H19BN4O4S and a molecular weight of 410.26 g/mol.
| Compound Name | CID 89260405 |
|---|---|
| PubChem CID | 89260405 |
| Molecular Formula | C19H19BN4O4S |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | — |
| SMILES | [B]c1cc2cnc(Nc3ccc(S(=O)(=O)N4CCOCC4)cc3)nc2cc1OC |
| InChI | InChI=1S/C19H19BN4O4S/c1-27-18-11-17-13(10-16(18)20)12-21-19(23-17)22-14-2-4-15(5-3-14)29(25,26)24-6-8-28-9-7-24/h2-5,10-12H,6-9H2,1H3,(H,21,22,23) |
| InChIKey | LYEDMIPGXLJQDX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|