C23H17Cl2N3O6 — CID 141480815
3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(5-methyl-2-nitroanilino)pyrano[3,2-c]pyridin-2-one (PubChem CID 141480815) has the molecular formula C23H17Cl2N3O6 and a molecular weight of 502.31 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(5-methyl-2-nitroanilino)pyrano[3,2-c]pyridin-2-one.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(5-methyl-2-nitroanilino)pyrano[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 141480815 |
| Molecular Formula | C23H17Cl2N3O6 |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-(5-methyl-2-nitroanilino)pyrano[3,2-c]pyridin-2-one |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4cc(C)ccc4[N+](=O)[O-])cc3oc2=O)c1Cl |
| InChI | InChI=1S/C23H17Cl2N3O6/c1-11-4-5-15(28(30)31)14(6-11)27-19-9-16-12(10-26-19)7-13(23(29)34-16)20-21(24)17(32-2)8-18(33-3)22(20)25/h4-10H,1-3H3,(H,26,27) |
| InChIKey | PCJGPHQGDFJUGB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|