C23H19Cl2N3O5 — CID 141480783
3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methyl-6-nitrophenyl)-2H-pyrano[3,2-c]pyridin-7-amine (PubChem CID 141480783) has the molecular formula C23H19Cl2N3O5 and a molecular weight of 488.33 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methyl-6-nitrophenyl)-2H-pyrano[3,2-c]pyridin-7-amine.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methyl-6-nitrophenyl)-2H-pyrano[3,2-c]pyridin-7-amine |
|---|---|
| PubChem CID | 141480783 |
| Molecular Formula | C23H19Cl2N3O5 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methyl-6-nitrophenyl)-2H-pyrano[3,2-c]pyridin-7-amine |
| SMILES | COc1cc(OC)c(Cl)c(C2=Cc3cnc(Nc4c(C)cccc4[N+](=O)[O-])cc3OC2)c1Cl |
| InChI | InChI=1S/C23H19Cl2N3O5/c1-12-5-4-6-15(28(29)30)23(12)27-19-9-16-13(10-26-19)7-14(11-33-16)20-21(24)17(31-2)8-18(32-3)22(20)25/h4-10H,11H2,1-3H3,(H,26,27) |
| InChIKey | RNPNXLZKRUVXCZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|