C26H25Cl2N3O3S — CID 142381524
N-[2-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)thieno[3,2-c]pyridin-6-yl]amino]-3-methylphenyl]formamide;prop-1-ene (PubChem CID 142381524) has the molecular formula C26H25Cl2N3O3S and a molecular weight of 530.48 g/mol. Its IUPAC name is N-[2-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)thieno[3,2-c]pyridin-6-yl]amino]-3-methylphenyl]formamide;prop-1-ene.
| Compound Name | N-[2-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)thieno[3,2-c]pyridin-6-yl]amino]-3-methylphenyl]formamide;prop-1-ene |
|---|---|
| PubChem CID | 142381524 |
| Molecular Formula | C26H25Cl2N3O3S |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | N-[2-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)thieno[3,2-c]pyridin-6-yl]amino]-3-methylphenyl]formamide;prop-1-ene |
| SMILES | C=CC.COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4c(C)cccc4NC=O)cc3s2)c1Cl |
| InChI | InChI=1S/C23H19Cl2N3O3S.C3H6/c1-12-5-4-6-14(27-11-29)23(12)28-19-9-17-13(10-26-19)7-18(32-17)20-21(24)15(30-2)8-16(31-3)22(20)25;1-3-2/h4-11H,1-3H3,(H,26,28)(H,27,29);3H,1H2,2H3 |
| InChIKey | CJWDBDGFEZXJQD-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|