C25H28Cl2N4O3 — CID 142330660
2-N-[5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]pyrimidin-2-yl]-1-N,3-dimethylbenzene-1,2-diamine;prop-2-enal (PubChem CID 142330660) has the molecular formula C25H28Cl2N4O3 and a molecular weight of 503.43 g/mol. Its IUPAC name is 2-N-[5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]pyrimidin-2-yl]-1-N,3-dimethylbenzene-1,2-diamine;prop-2-enal.
| Compound Name | 2-N-[5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]pyrimidin-2-yl]-1-N,3-dimethylbenzene-1,2-diamine;prop-2-enal |
|---|---|
| PubChem CID | 142330660 |
| Molecular Formula | C25H28Cl2N4O3 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-N-[5-[2-(2,6-dichloro-3,5-dimethoxyphenyl)ethyl]pyrimidin-2-yl]-1-N,3-dimethylbenzene-1,2-diamine;prop-2-enal |
| SMILES | C=CC=O.CNc1cccc(C)c1Nc1ncc(CCc2c(Cl)c(OC)cc(OC)c2Cl)cn1 |
| InChI | InChI=1S/C22H24Cl2N4O2.C3H4O/c1-13-6-5-7-16(25-2)21(13)28-22-26-11-14(12-27-22)8-9-15-19(23)17(29-3)10-18(30-4)20(15)24;1-2-3-4/h5-7,10-12,25H,8-9H2,1-4H3,(H,26,27,28);2-3H,1H2 |
| InChIKey | URBIFPQZLHUDIG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|