C23H24ClN5O3 — CID 142330746
4-chloro-3-[[2-[2-methyl-6-(methylamino)anilino]pyrimidin-5-yl]oxymethyl]benzamide;prop-2-enal (PubChem CID 142330746) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is 4-chloro-3-[[2-[2-methyl-6-(methylamino)anilino]pyrimidin-5-yl]oxymethyl]benzamide;prop-2-enal.
| Compound Name | 4-chloro-3-[[2-[2-methyl-6-(methylamino)anilino]pyrimidin-5-yl]oxymethyl]benzamide;prop-2-enal |
|---|---|
| PubChem CID | 142330746 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-chloro-3-[[2-[2-methyl-6-(methylamino)anilino]pyrimidin-5-yl]oxymethyl]benzamide;prop-2-enal |
| SMILES | C=CC=O.CNc1cccc(C)c1Nc1ncc(OCc2cc(C(N)=O)ccc2Cl)cn1 |
| InChI | InChI=1S/C20H20ClN5O2.C3H4O/c1-12-4-3-5-17(23-2)18(12)26-20-24-9-15(10-25-20)28-11-14-8-13(19(22)27)6-7-16(14)21;1-2-3-4/h3-10,23H,11H2,1-2H3,(H2,22,27)(H,24,25,26);2-3H,1H2 |
| InChIKey | VQNBKLVCJLCGNR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|