C31H33Cl2N5O2 — CID 167095624
1-N-(cyclopentylmethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-N-[2-(ethenylamino)-6-methylphenyl]-2,6-naphthyridine-1,7-diamine (PubChem CID 167095624) has the molecular formula C31H33Cl2N5O2 and a molecular weight of 578.54 g/mol. Its IUPAC name is 1-N-(cyclopentylmethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-N-[2-(ethenylamino)-6-methylphenyl]-2,6-naphthyridine-1,7-diamine.
| Compound Name | 1-N-(cyclopentylmethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-N-[2-(ethenylamino)-6-methylphenyl]-2,6-naphthyridine-1,7-diamine |
|---|---|
| PubChem CID | 167095624 |
| Molecular Formula | C31H33Cl2N5O2 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 1-N-(cyclopentylmethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-N-[2-(ethenylamino)-6-methylphenyl]-2,6-naphthyridine-1,7-diamine |
| SMILES | C=CNc1cccc(C)c1Nc1cc2c(NCC3CCCC3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C31H33Cl2N5O2/c1-5-34-22-12-8-9-18(2)30(22)38-26-14-21-20(17-35-26)13-23(37-31(21)36-16-19-10-6-7-11-19)27-28(32)24(39-3)15-25(40-4)29(27)33/h5,8-9,12-15,17,19,34H,1,6-7,10-11,16H2,2-4H3,(H,35,38)(H,36,37) |
| InChIKey | PDZPSZNULWNWRA-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |