C21H18F2N4O4 — CID 122604662
5-[(E)-2-(2,6-difluoro-3,5-dimethoxyphenyl)ethenyl]-N-(2-methyl-6-nitrophenyl)pyrimidin-2-amine (PubChem CID 122604662) has the molecular formula C21H18F2N4O4 and a molecular weight of 428.40 g/mol. Its IUPAC name is 5-[(E)-2-(2,6-difluoro-3,5-dimethoxyphenyl)ethenyl]-N-(2-methyl-6-nitrophenyl)pyrimidin-2-amine.
| Compound Name | 5-[(E)-2-(2,6-difluoro-3,5-dimethoxyphenyl)ethenyl]-N-(2-methyl-6-nitrophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 122604662 |
| Molecular Formula | C21H18F2N4O4 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 5-[(E)-2-(2,6-difluoro-3,5-dimethoxyphenyl)ethenyl]-N-(2-methyl-6-nitrophenyl)pyrimidin-2-amine |
| SMILES | COc1cc(OC)c(F)c(/C=C/c2cnc(Nc3c(C)cccc3[N+](=O)[O-])nc2)c1F |
| InChI | InChI=1S/C21H18F2N4O4/c1-12-5-4-6-15(27(28)29)20(12)26-21-24-10-13(11-25-21)7-8-14-18(22)16(30-2)9-17(31-3)19(14)23/h4-11H,1-3H3,(H,24,25,26)/b8-7+ |
| InChIKey | OCHVGUVZPRNROB-BQYQJAHWSA-N |
| XLogP | 4.90 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|