C26H27Cl2FN6O4 — CID 139514559
5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)-6-nitrophenyl]pyrimidin-2-amine (PubChem CID 139514559) has the molecular formula C26H27Cl2FN6O4 and a molecular weight of 577.44 g/mol. Its IUPAC name is 5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)-6-nitrophenyl]pyrimidin-2-amine.
| Compound Name | 5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)-6-nitrophenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 139514559 |
| Molecular Formula | C26H27Cl2FN6O4 |
| Molecular Weight | 577.44 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)-6-nitrophenyl]pyrimidin-2-amine |
| SMILES | COc1cc(OC)c(Cl)c(/C(F)=C/c2cnc(Nc3c(C)cc(N4CCN(C)CC4)cc3[N+](=O)[O-])nc2)c1Cl |
| InChI | InChI=1S/C26H27Cl2FN6O4/c1-15-9-17(34-7-5-33(2)6-8-34)11-19(35(36)37)25(15)32-26-30-13-16(14-31-26)10-18(29)22-23(27)20(38-3)12-21(39-4)24(22)28/h9-14H,5-8H2,1-4H3,(H,30,31,32)/b18-10- |
| InChIKey | LMMVJILMOHGSPW-ZDLGFXPLSA-N |
| XLogP | 5.98 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|