C24H25F2N5O6 — CID 122604552
5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-(2-methyl-4-morpholin-4-yl-6-nitrophenyl)pyrimidin-2-amine (PubChem CID 122604552) has the molecular formula C24H25F2N5O6 and a molecular weight of 517.49 g/mol. Its IUPAC name is 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-(2-methyl-4-morpholin-4-yl-6-nitrophenyl)pyrimidin-2-amine.
| Compound Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-(2-methyl-4-morpholin-4-yl-6-nitrophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 122604552 |
| Molecular Formula | C24H25F2N5O6 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-(2-methyl-4-morpholin-4-yl-6-nitrophenyl)pyrimidin-2-amine |
| SMILES | COc1cc(OC)c(F)c(COc2cnc(Nc3c(C)cc(N4CCOCC4)cc3[N+](=O)[O-])nc2)c1F |
| InChI | InChI=1S/C24H25F2N5O6/c1-14-8-15(30-4-6-36-7-5-30)9-18(31(32)33)23(14)29-24-27-11-16(12-28-24)37-13-17-21(25)19(34-2)10-20(35-3)22(17)26/h8-12H,4-7,13H2,1-3H3,(H,27,28,29) |
| InChIKey | GMRGILHHKBFSGP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|