C39H42F2N4O8 — CID 158278903
[5-[[2-amino-4-(4-ethylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone (PubChem CID 158278903) has the molecular formula C39H42F2N4O8 and a molecular weight of 732.78 g/mol. Its IUPAC name is [5-[[2-amino-4-(4-ethylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone.
| Compound Name | [5-[[2-amino-4-(4-ethylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 158278903 |
| Molecular Formula | C39H42F2N4O8 |
| Molecular Weight | 732.78 g/mol |
| Exact Mass | 732.30 |
| IUPAC Name | [5-[[2-amino-4-(4-ethylpiperazin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
| SMILES | CCN1CCN(c2ccc(Cc3cc4c(OCc5cc(OC)c(OC)c(OC)c5)c(C(=O)c5c(F)c(OC)cc(OC)c5F)oc4cn3)c(N)c2)CC1 |
| InChI | InChI=1S/C39H42F2N4O8/c1-7-44-10-12-45(13-11-44)25-9-8-23(27(42)18-25)16-24-17-26-32(20-43-24)53-39(36(46)33-34(40)28(47-2)19-29(48-3)35(33)41)37(26)52-21-22-14-30(49-4)38(51-6)31(15-22)50-5/h8-9,14-15,17-20H,7,10-13,16,21,42H2,1-6H3 |
| InChIKey | GJYQRKAWUDURFK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.78 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|