C38H41F2N5O8 — CID 151039108
[5-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone (PubChem CID 151039108) has the molecular formula C38H41F2N5O8 and a molecular weight of 733.77 g/mol. Its IUPAC name is [5-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone.
| Compound Name | [5-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 151039108 |
| Molecular Formula | C38H41F2N5O8 |
| Molecular Weight | 733.77 g/mol |
| Exact Mass | 733.29 |
| IUPAC Name | [5-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]-3-[(3,4,5-trimethoxyphenyl)methoxy]furo[2,3-c]pyridin-2-yl]-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
| SMILES | CCN1CCN(c2ccc(Nc3cc4c(OCc5cc(OC)c(OC)c(OC)c5)c(C(=O)c5c(F)c(OC)cc(OC)c5F)oc4cn3)c(N)c2)CC1 |
| InChI | InChI=1S/C38H41F2N5O8/c1-7-44-10-12-45(13-11-44)22-8-9-25(24(41)16-22)43-31-17-23-30(19-42-31)53-38(35(46)32-33(39)26(47-2)18-27(48-3)34(32)40)36(23)52-20-21-14-28(49-4)37(51-6)29(15-21)50-5/h8-9,14-19H,7,10-13,20,41H2,1-6H3,(H,42,43) |
| InChIKey | MBRSRZYVPJWGKD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.77 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|