C27H37N7O — CID 164983888
ethane;1-methyl-3-phenyl-1-[6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea (PubChem CID 164983888) has the molecular formula C27H37N7O and a molecular weight of 475.64 g/mol. Its IUPAC name is ethane;1-methyl-3-phenyl-1-[6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea.
| Compound Name | ethane;1-methyl-3-phenyl-1-[6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 164983888 |
| Molecular Formula | C27H37N7O |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | ethane;1-methyl-3-phenyl-1-[6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]urea |
| SMILES | CC.CC(C)N1CCN(c2ccc(Nc3cc(N(C)C(=O)Nc4ccccc4)ncn3)cc2)CC1 |
| InChI | InChI=1S/C25H31N7O.C2H6/c1-19(2)31-13-15-32(16-14-31)22-11-9-21(10-12-22)28-23-17-24(27-18-26-23)30(3)25(33)29-20-7-5-4-6-8-20;1-2/h4-12,17-19H,13-16H2,1-3H3,(H,29,33)(H,26,27,28);1-2H3 |
| InChIKey | FWMNRWLNWAFZPZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|