C29H23Cl2N5O3 — CID 177374706
N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1H-pyrrol-2-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 177374706) has the molecular formula C29H23Cl2N5O3 and a molecular weight of 560.44 g/mol. Its IUPAC name is N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1H-pyrrol-2-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1H-pyrrol-2-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177374706 |
| Molecular Formula | C29H23Cl2N5O3 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1H-pyrrol-2-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(-c3ccc[nH]3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C29H23Cl2N5O3/c1-4-25(37)35-19-9-6-5-8-18(19)34-24-13-17-16(15-33-24)12-21(36-29(17)20-10-7-11-32-20)26-27(30)22(38-2)14-23(39-3)28(26)31/h4-15,32H,1H2,2-3H3,(H,33,34)(H,35,37) |
| InChIKey | OJVFQPGRWNUDCZ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|