C25H23Cl2N5O4 — CID 135180233
N-[5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 135180233) has the molecular formula C25H23Cl2N5O4 and a molecular weight of 528.40 g/mol. Its IUPAC name is N-[5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180233 |
| Molecular Formula | C25H23Cl2N5O4 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | N-[5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnn(CCOC)c1-c1cc2cnc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C25H23Cl2N5O4/c1-5-21(33)31-18-13-30-32(6-7-34-2)25(18)17-9-15-11-28-16(8-14(15)12-29-17)22-23(26)19(35-3)10-20(36-4)24(22)27/h5,8-13H,1,6-7H2,2-4H3,(H,31,33) |
| InChIKey | DHYVEZOZYOZZDT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|