C28H33Cl2N7O5 — CID 139396128
N-[5-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-methoxyethylimino)-5-methyl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 139396128) has the molecular formula C28H33Cl2N7O5 and a molecular weight of 618.52 g/mol. Its IUPAC name is N-[5-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-methoxyethylimino)-5-methyl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[5-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-methoxyethylimino)-5-methyl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139396128 |
| Molecular Formula | C28H33Cl2N7O5 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | N-[5-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2-methoxyethylimino)-5-methyl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]-1-(2-methoxyethyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnn(CCOC)c1-c1ncc2c(n1)/C(=N/CCOC)NC(c1c(Cl)c(OC)cc(OC)c1Cl)C2C |
| InChI | InChI=1S/C28H33Cl2N7O5/c1-7-20(38)34-17-14-33-37(9-11-40-4)26(17)28-32-13-16-15(2)24(35-27(25(16)36-28)31-8-10-39-3)21-22(29)18(41-5)12-19(42-6)23(21)30/h7,12-15,24H,1,8-11H2,2-6H3,(H,31,35)(H,34,38) |
| InChIKey | RFXQDBRMQSAVEF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|