C23H25F2N5O3 — CID 164782001
N-[5-[6-(2,6-difluoro-3,5-dimethoxyphenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazol-3-yl]-1-methylpyrazol-4-yl]prop-2-enamide (PubChem CID 164782001) has the molecular formula C23H25F2N5O3 and a molecular weight of 457.48 g/mol. Its IUPAC name is N-[5-[6-(2,6-difluoro-3,5-dimethoxyphenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazol-3-yl]-1-methylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[5-[6-(2,6-difluoro-3,5-dimethoxyphenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazol-3-yl]-1-methylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 164782001 |
| Molecular Formula | C23H25F2N5O3 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[5-[6-(2,6-difluoro-3,5-dimethoxyphenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazol-3-yl]-1-methylpyrazol-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnn(C)c1-c1n[nH]c2c1CC(C)C(c1c(F)c(OC)cc(OC)c1F)C2 |
| InChI | InChI=1S/C23H25F2N5O3/c1-6-18(31)27-15-10-26-30(3)23(15)22-13-7-11(2)12(8-14(13)28-29-22)19-20(24)16(32-4)9-17(33-5)21(19)25/h6,9-12H,1,7-8H2,2-5H3,(H,27,31)(H,28,29) |
| InChIKey | WGCUAWPOTUNPFO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|