C29H35Cl2N5O3 — CID 138457991
N-[2-[(6R)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-enamide (PubChem CID 138457991) has the molecular formula C29H35Cl2N5O3 and a molecular weight of 572.54 g/mol. Its IUPAC name is N-[2-[(6R)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[(6R)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138457991 |
| Molecular Formula | C29H35Cl2N5O3 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | N-[2-[(6R)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(N(C)CCN(C)C)cc1-c1n[nH]c2c1CC[C@@H](c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C29H35Cl2N5O3/c1-7-25(37)32-21-11-9-18(36(4)13-12-35(2)3)15-20(21)29-19-10-8-17(14-22(19)33-34-29)26-27(30)23(38-5)16-24(39-6)28(26)31/h7,9,11,15-17H,1,8,10,12-14H2,2-6H3,(H,32,37)(H,33,34)/t17-/m1/s1 |
| InChIKey | HQHAEKLTISEASH-QGZVFWFLSA-N |
| XLogP | 5.80 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|