C30H36Cl2N4O3 — CID 154987636
N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-(dipropylamino)phenyl]prop-2-enamide (PubChem CID 154987636) has the molecular formula C30H36Cl2N4O3 and a molecular weight of 571.55 g/mol. Its IUPAC name is N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-(dipropylamino)phenyl]prop-2-enamide.
| Compound Name | N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-(dipropylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154987636 |
| Molecular Formula | C30H36Cl2N4O3 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-4-(dipropylamino)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(N(CCC)CCC)cc1-c1n[nH]c2c1CCC(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C30H36Cl2N4O3/c1-6-13-36(14-7-2)19-10-12-22(33-26(37)8-3)21(16-19)30-20-11-9-18(15-23(20)34-35-30)27-28(31)24(38-4)17-25(39-5)29(27)32/h8,10,12,16-18H,3,6-7,9,11,13-15H2,1-2,4-5H3,(H,33,37)(H,34,35) |
| InChIKey | UIWRQGJLAFCGRM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|