C26H28Cl2N4O4 — CID 155065796
N-[2-[(6S)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-6-hydroxy-1,4,5,7-tetrahydroindazol-3-yl]-4-(dimethylamino)phenyl]prop-2-enamide (PubChem CID 155065796) has the molecular formula C26H28Cl2N4O4 and a molecular weight of 531.44 g/mol. Its IUPAC name is N-[2-[(6S)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-6-hydroxy-1,4,5,7-tetrahydroindazol-3-yl]-4-(dimethylamino)phenyl]prop-2-enamide.
| Compound Name | N-[2-[(6S)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-6-hydroxy-1,4,5,7-tetrahydroindazol-3-yl]-4-(dimethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155065796 |
| Molecular Formula | C26H28Cl2N4O4 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-[2-[(6S)-6-(2,6-dichloro-3,5-dimethoxyphenyl)-6-hydroxy-1,4,5,7-tetrahydroindazol-3-yl]-4-(dimethylamino)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(N(C)C)cc1-c1n[nH]c2c1CC[C@@](O)(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C26H28Cl2N4O4/c1-6-21(33)29-17-8-7-14(32(2)3)11-16(17)25-15-9-10-26(34,13-18(15)30-31-25)22-23(27)19(35-4)12-20(36-5)24(22)28/h6-8,11-12,34H,1,9-10,13H2,2-5H3,(H,29,33)(H,30,31)/t26-/m0/s1 |
| InChIKey | BVGASEZDFROVLL-SANMLTNESA-N |
| XLogP | 4.97 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|