C24H25Cl2N3O4 — CID 158274351
5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-methoxyethylamino)-2,6-naphthyridin-3-yl]pent-1-en-3-one (PubChem CID 158274351) has the molecular formula C24H25Cl2N3O4 and a molecular weight of 490.39 g/mol. Its IUPAC name is 5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-methoxyethylamino)-2,6-naphthyridin-3-yl]pent-1-en-3-one.
| Compound Name | 5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-methoxyethylamino)-2,6-naphthyridin-3-yl]pent-1-en-3-one |
|---|---|
| PubChem CID | 158274351 |
| Molecular Formula | C24H25Cl2N3O4 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 5-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2-methoxyethylamino)-2,6-naphthyridin-3-yl]pent-1-en-3-one |
| SMILES | C=CC(=O)CCc1cc2c(NCCOC)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C24H25Cl2N3O4/c1-5-16(30)7-6-15-11-17-14(13-28-15)10-18(29-24(17)27-8-9-31-2)21-22(25)19(32-3)12-20(33-4)23(21)26/h5,10-13H,1,6-9H2,2-4H3,(H,27,29) |
| InChIKey | ZCYXYUHZUKBGPQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|