C19H18Cl3N3O3 — CID 139385604
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-2,6-naphthyridin-1-amine (PubChem CID 139385604) has the molecular formula C19H18Cl3N3O3 and a molecular weight of 442.73 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-2,6-naphthyridin-1-amine.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 139385604 |
| Molecular Formula | C19H18Cl3N3O3 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-2,6-naphthyridin-1-amine |
| SMILES | COCCNc1nc(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(Cl)cc12 |
| InChI | InChI=1S/C19H18Cl3N3O3/c1-26-5-4-23-19-11-7-15(20)24-9-10(11)6-12(25-19)16-17(21)13(27-2)8-14(28-3)18(16)22/h6-9H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | IBDVRNAEUKRBFW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|