C17H14Cl2N2O2 — CID 135181041
3-chloro-7-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine (PubChem CID 135181041) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 3-chloro-7-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine.
| Compound Name | 3-chloro-7-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine |
|---|---|
| PubChem CID | 135181041 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-chloro-7-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3cn2)c1C |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-9-13(22-2)6-14(23-3)17(19)16(9)12-4-10-8-21-15(18)5-11(10)7-20-12/h4-8H,1-3H3 |
| InChIKey | OHGHPUCLVQOBLJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|