About 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine
6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine (PubChem CID 135181366) has the molecular formula C19H20ClN3O2S
and a molecular weight of 389.91 g/mol. Its IUPAC name is 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine |
| PubChem CID | 135181366 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine |
| SMILES | CCc1nc(-c2c(C)c(OC)cc(OC)c2Cl)cc2cnc(SC)nc12 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-6-12-18-11(9-21-19(23-18)26-5)7-13(22-12)16-10(2)14(24-3)8-15(25-4)17(16)20/h7-9H,6H2,1-5H3 |
| InChIKey | PEUKTCZECDNIAI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine?
The IUPAC name of 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine (CID 135181366) is 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine.
What is the SMILES notation for 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine?
The canonical SMILES for 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine is CCc1nc(-c2c(C)c(OC)cc(OC)c2Cl)cc2cnc(SC)nc12.
What is the InChIKey of 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine?
The InChIKey is PEUKTCZECDNIAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN3O2S/c1-6-12-18-11(9-21-19(23-18)26-5)7-13(22-12)16-10(2)14(24-3)8-15(25-4)17(16)20/h7-9H,6H2,1-5H3.
What are the key properties of 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine?
6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine has a molecular weight of 389.91 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloro-3,5-dimethoxy-6-methylphenyl)-8-ethyl-2-methylsulfanylpyrido[3,4-d]pyrimidine is sourced from PubChem (CID 135181366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).