C22H21Cl2N3O2 — CID 139395439
1-(3-azabicyclo[3.1.0]hexan-3-yl)-7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine (PubChem CID 139395439) has the molecular formula C22H21Cl2N3O2 and a molecular weight of 430.34 g/mol. Its IUPAC name is 1-(3-azabicyclo[3.1.0]hexan-3-yl)-7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine.
| Compound Name | 1-(3-azabicyclo[3.1.0]hexan-3-yl)-7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine |
|---|---|
| PubChem CID | 139395439 |
| Molecular Formula | C22H21Cl2N3O2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-(3-azabicyclo[3.1.0]hexan-3-yl)-7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-2,6-naphthyridine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(N3CC4CC4C3)n2)c1C |
| InChI | InChI=1S/C22H21Cl2N3O2/c1-11-17(28-2)7-18(29-3)21(24)20(11)16-5-12-8-25-19(23)6-15(12)22(26-16)27-9-13-4-14(13)10-27/h5-8,13-14H,4,9-10H2,1-3H3 |
| InChIKey | WPZHJOQKMOAFRC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|