C20H18Cl3N3O3 — CID 135181397
4-[7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-yl]morpholine (PubChem CID 135181397) has the molecular formula C20H18Cl3N3O3 and a molecular weight of 454.74 g/mol. Its IUPAC name is 4-[7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-yl]morpholine.
| Compound Name | 4-[7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-yl]morpholine |
|---|---|
| PubChem CID | 135181397 |
| Molecular Formula | C20H18Cl3N3O3 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 4-[7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-yl]morpholine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(N3CCOCC3)n2)c1Cl |
| InChI | InChI=1S/C20H18Cl3N3O3/c1-27-14-9-15(28-2)19(23)17(18(14)22)13-7-11-10-24-16(21)8-12(11)20(25-13)26-3-5-29-6-4-26/h7-10H,3-6H2,1-2H3 |
| InChIKey | GFAIOWWGQRKCBH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|